CMap Candidate Details
Structure:
| CMap ID: | C01700 |
| Pert ID: | BRD-K48722258 |
| Compound Name: | dilazep |
| Targets: | SLC29A1 |
| MoA: | adenosine reuptake inhibitor |
| SMILES: | COc1cc(cc(OC)c1OC)C(=O)OCCCN1CCCN(CCCOC(=O)c2cc(OC)c(OC)c(OC)c2)CC1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 6885 | BRD-K48722258 | A375 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 7003 | BRD-K48722258 | A549 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 7451 | BRD-K48722258 | HA1E | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 8005 | BRD-K48722258 | HT29 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.38 | -1.29 | 1.52 |
| 8821 | BRD-K48722258 | VCAP | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 91202 | BRD-K48722258 | HUH7 | 6.66 uM | 72 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 97579 | BRD-K48722258 | NKDBA | 0.37 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 99594 | BRD-K48722258 | U2OS | 10 uM | 6 h | 0.21 | 0.87 | 0.01 | 0.0 | 0.0 | 0.0 |
| 125659 | BRD-K48722258 | HEK293 | 3.33 uM | 24 h | 0.18 | 0.76 | 0.0 | 0.0 | 0.0 | 0.0 |
| 125681 | BRD-K48722258 | HELA | 3.33 uM | 24 h | 0.34 | 1.42 | 1.03 | 0.0 | 0.0 | 0.0 |
| 125752 | BRD-K48722258 | HUVEC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 125809 | BRD-K48722258 | MCF10A | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.28 | -0.95 | 0.41 |
| 125834 | BRD-K48722258 | MCF??7.00 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.26 | -0.89 | 0.26 |
| 125857 | BRD-K48722258 | MDAMB231 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 125950 | BRD-K48722258 | YAPC | 10 uM | 24 h | 0.22 | 0.91 | 0.03 | 0.44 | 1.54 | 2.31 |
| 133834 | BRD-K48722258 | JURKAT | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 133955 | BRD-K48722258 | PC3 | 0.01 uM | 24 h | 0.3 | 1.25 | 0.54 | 0.0 | 0.0 | 0.0 |
| 133989 | BRD-K48722258 | THP1 | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |