CMap Candidate Details
Structure:
| CMap ID: | C01712 |
| Pert ID: | BRD-K73391359 |
| Compound Name: | dimethisoquin |
| Targets: | |
| MoA: | local anesthetic |
| SMILES: | CCCCc1cc2ccccc2c(OCCN(C)C)n1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 1618 | BRD-K73391359 | HA1E | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.25 | 0.9 | 0.22 |
| 1964 | BRD-K73391359 | HCC515 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 2199 | BRD-K73391359 | PC3 | 10 uM | 24 h | 0.26 | 1.07 | 0.2 | -0.28 | -0.93 | 0.35 |
| 2687 | BRD-K73391359 | VCAP | 10 uM | 6 h | -0.22 | -0.92 | 0.06 | -0.26 | -0.87 | 0.24 |
| 42139 | BRD-K73391359 | A549 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 42462 | BRD-K73391359 | ASC | 10 uM | 24 h | -0.24 | -1.0 | 0.15 | 0.27 | 0.95 | 0.31 |
| 42773 | BRD-K73391359 | HEPG2 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.32 | -1.08 | 0.78 |
| 43069 | BRD-K73391359 | HT29 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.28 | 0.99 | 0.41 |
| 43640 | BRD-K73391359 | NPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.34 | -1.13 | 0.98 |
| 43939 | BRD-K73391359 | PHH | 10 uM | 24 h | 0.26 | 1.08 | 0.21 | 0.0 | 0.0 | 0.0 |
| 44194 | BRD-K73391359 | SKB | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 51632 | BRD-K73391359 | MCF??7.00 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.32 | -1.07 | 0.75 |
| 99447 | BRD-K73391359 | U2OS | 6.66 uM | 6 h | -0.19 | -0.78 | 0.0 | 0.27 | 0.94 | 0.29 |