CMap Candidate Details
Structure:
| CMap ID: | C01718 |
| Pert ID: | BRD-K60567437 |
| Compound Name: | dimpylate |
| Targets: | ACHE |
| MoA: | acetylcholinesterase inhibitor |
| SMILES: | CCOP(=S)(OCC)Oc1cc(C)nc(n1)C(C)C |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 52683 | BRD-K60567437 | A549 | 20 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 52747 | BRD-K60567437 | HEPG2 | 2.5 uM | 24 h | -0.3 | -1.27 | 0.74 | -0.31 | -1.05 | 0.69 |
| 97127 | BRD-K60567437 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.33 | -1.12 | 0.93 |
| 97195 | BRD-K60567437 | PC3 | 10 uM | 24 h | -0.23 | -0.96 | 0.09 | 0.0 | 0.0 | 0.0 |