CMap Candidate Details
Structure:
| CMap ID: | C01729 |
| Pert ID: | BRD-A30693873 |
| Compound Name: | diperodon |
| Targets: | |
| MoA: | local anesthetic |
| SMILES: | O=C(Nc1ccccc1)OCC(CN1CCCCC1)OC(=O)Nc1ccccc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 51348 | BRD-A30693873 | MCF??7.00 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 51391 | BRD-A30693873 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |