CMap Candidate Details
Structure:
| CMap ID: | C01800 |
| Pert ID: | BRD-K01824921 |
| Compound Name: | DPCPX |
| Targets: | ADORA1|ADORA2A|ADORA2B|ADORA3 |
| MoA: | adenosine receptor antagonist |
| SMILES: | CCCn1c2[nH]c(nc2c(=O)n(CCC)c1=O)C1CCCC1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 96484 | BRD-K01824921 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 99964 | BRD-K01824921 | U2OS | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 122847 | BRD-K01824921 | A549 | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 122898 | BRD-K01824921 | HEK293 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 122974 | BRD-K01824921 | HT29 | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 123023 | BRD-K01824921 | JURKAT | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.22 | -0.73 | 0.05 |
| 123112 | BRD-K01824921 | MDAMB231 | 10 uM | 24 h | 0.34 | 1.41 | 1.03 | 0.24 | 0.84 | 0.13 |
| 123184 | BRD-K01824921 | THP1 | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.24 | -0.81 | 0.12 |
| 131281 | BRD-K01824921 | HA1E | 0.74 uM | 24 h | 0.25 | 1.02 | 0.13 | 0.0 | 0.0 | 0.0 |
| 131307 | BRD-K01824921 | HELA | 0.03 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.38 | 1.33 | 1.72 |
| 131360 | BRD-K01824921 | HUVEC | 0.08 uM | 24 h | 0.29 | 1.22 | 0.48 | 0.34 | 1.19 | 1.02 |
| 131400 | BRD-K01824921 | MCF10A | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 131438 | BRD-K01824921 | MCF??7.00 | 0.01 uM | 24 h | -0.24 | -0.98 | 0.12 | -0.29 | -0.99 | 0.5 |
| 131465 | BRD-K01824921 | PC3 | 0.25 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.23 | 0.83 | 0.12 |
| 131498 | BRD-K01824921 | YAPC | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |