CMap Candidate Details
Structure:
| CMap ID: | C01802 |
| Pert ID: | BRD-K99922388 |
| Compound Name: | DPO-1 |
| Targets: | KCNA5 |
| MoA: | potassium channel blocker |
| SMILES: | CC(C)[C@@H]1CC[C@@H](C)C[C@@H]1P(=O)(c1ccccc1)c1ccccc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 6820 | BRD-K99922388 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 7200 | BRD-K99922388 | A549 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 7368 | BRD-K99922388 | HA1E | 10 uM | 24 h | -0.26 | -1.07 | 0.27 | -0.29 | -0.97 | 0.45 |
| 7737 | BRD-K99922388 | HCC515 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.24 | -0.8 | 0.12 |
| 7928 | BRD-K99922388 | HT29 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 8217 | BRD-K99922388 | MCF??7.00 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 8419 | BRD-K99922388 | PC3 | 10 uM | 24 h | -0.25 | -1.03 | 0.19 | 0.28 | 1.0 | 0.43 |
| 8741 | BRD-K99922388 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.28 | -0.94 | 0.37 |