CMap Candidate Details
Structure:
| CMap ID: | C01817 |
| Pert ID: | BRD-K20372197 |
| Compound Name: | droxidopa |
| Targets: | ADRA1A|ADRA1B|ADRA1D|ADRA2A|ADRA2B|ADRA2C|ADRB1|ADRB2|ADRB3|PAH |
| MoA: | norepinephrine precursor |
| SMILES: | N[C@@H]([C@H](O)c1ccc(O)c(O)c1)C(O)=O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 96588 | BRD-K20372197 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 96660 | BRD-K20372197 | PC3 | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |