CMap Candidate Details
Structure:
| CMap ID: | C01867 |
| Pert ID: | BRD-K22514639 |
| Compound Name: | EGF816 |
| Targets: | EGFR |
| MoA: | EGFR inhibitor |
| SMILES: | CN(C)C\C=C\C(=O)N1CCCC[C@H](C1)n1c(NC(=O)c2ccnc(C)c2)nc2cccc(Cl)c12 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 87998 | BRD-K22514639 | A549 | 20 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 88042 | BRD-K22514639 | MCF??7.00 | 20 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.24 | -0.79 | 0.11 |