CMap Candidate Details
Structure:
| CMap ID: | C02030 |
| Pert ID: | BRD-A30205217 |
| Compound Name: | ethotoin |
| Targets: | SCN10A|SCN11A|SCN1A|SCN2A|SCN3A|SCN4A|SCN5A|SCN7A|SCN8A|SCN9A |
| MoA: | hydantoin antiepileptic |
| SMILES: | CCN1C(=O)NC(C1=O)c1ccccc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 6628 | BRD-A30205217 | A375 | 10 uM | 24 h | -0.24 | -0.98 | 0.12 | 0.0 | 0.0 | 0.0 |
| 6922 | BRD-A30205217 | A549 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.21 | -0.72 | 0.04 |
| 7384 | BRD-A30205217 | HA1E | 10 uM | 6 h | 0.33 | 1.39 | 1.01 | 0.0 | 0.0 | 0.0 |
| 7519 | BRD-A30205217 | HCC515 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 7937 | BRD-A30205217 | HT29 | 10 uM | 6 h | 0.22 | 0.93 | 0.05 | 0.22 | 0.79 | 0.07 |
| 8432 | BRD-A30205217 | PC3 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 8561 | BRD-A30205217 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 51666 | BRD-A30205217 | MCF??7.00 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |