CMap Candidate Details
Structure:
| CMap ID: | C02084 |
| Pert ID: | BRD-K65716359 |
| Compound Name: | exifone |
| Targets: | TYR |
| MoA: | nootropic agent |
| SMILES: | Oc1ccc(C(=O)c2cc(O)c(O)c(O)c2)c(O)c1O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 95769 | BRD-K65716359 | A375 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 95793 | BRD-K65716359 | MCF??7.00 | 10 uM | 6 h | -0.23 | -0.95 | 0.09 | 0.0 | 0.0 | 0.0 |
| 95838 | BRD-K65716359 | A549 | 10 uM | 6 h | 0.23 | 0.94 | 0.06 | 0.0 | 0.0 | 0.0 |
| 95872 | BRD-K65716359 | PC3 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 95927 | BRD-K65716359 | YAPC | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 98923 | BRD-K65716359 | NEU | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 99173 | BRD-K65716359 | NPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |