CMap Candidate Details
Structure:
| CMap ID: | C02091 |
| Pert ID: | BRD-K05444225 |
| Compound Name: | E7449 |
| Targets: | PARP1|PARP2|TNKS|TNKS2 |
| MoA: | PARP inhibitor |
| SMILES: | O=c1[nH][nH]c2nc(CN3Cc4ccccc4C3)nc3cccc1c23 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 96492 | BRD-K05444225 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.22 | -0.75 | 0.06 |
| 96560 | BRD-K05444225 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |