CMap Candidate Details
Structure:
| CMap ID: | C02097 |
| Pert ID: | BRD-K00673382 |
| Compound Name: | famotidine |
| Targets: | HRH2 |
| MoA: | histamine receptor antagonist |
| SMILES: | NC(N)=Nc1nc(CSCC\C(N)=N/S(N)(=O)=O)cs1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 25316 | BRD-K00673382 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 51293 | BRD-K00673382 | MCF??7.00 | 10 uM | 6 h | -0.18 | -0.76 | 0.0 | 0.0 | 0.0 | 0.0 |
| 91054 | BRD-K00673382 | HUH7 | 10 uM | 72 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 99950 | BRD-K00673382 | U2OS | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 122883 | BRD-K00673382 | HEK293 | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 122964 | BRD-K00673382 | HT29 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.28 | 0.98 | 0.37 |
| 123008 | BRD-K00673382 | JURKAT | 1.11 uM | 24 h | -0.22 | -0.91 | 0.05 | -0.22 | -0.75 | 0.07 |
| 123056 | BRD-K00673382 | MCF10A | 0.04 uM | 24 h | -0.23 | -0.94 | 0.08 | 0.0 | 0.0 | 0.0 |
| 123097 | BRD-K00673382 | MDAMB231 | 0.125 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 123143 | BRD-K00673382 | PC3 | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.23 | 0.8 | 0.08 |
| 123169 | BRD-K00673382 | THP1 | 0.04 uM | 24 h | -0.34 | -1.42 | 1.42 | -0.29 | -0.99 | 0.5 |
| 131202 | BRD-K00673382 | A375 | 0.74 uM | 24 h | -0.27 | -1.14 | 0.42 | 0.0 | 0.0 | 0.0 |
| 131234 | BRD-K00673382 | A549 | 0.25 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 131273 | BRD-K00673382 | HA1E | 0.74 uM | 24 h | 0.31 | 1.3 | 0.73 | 0.0 | 0.0 | 0.0 |
| 131299 | BRD-K00673382 | HELA | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 131345 | BRD-K00673382 | HUVEC | 0.03 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.32 | 1.13 | 0.82 |
| 131486 | BRD-K00673382 | YAPC | 0.03 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |