CMap Candidate Details
Structure:
| CMap ID: | C02102 |
| Pert ID: | BRD-A49622760 |
| Compound Name: | faropenem |
| Targets: | |
| MoA: | lactamase inhibitor |
| SMILES: | CC(O)C1C2SC(C3CCCO3)=C(N2C1=O)C(O)=O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 125243 | BRD-A49622760 | A375 | 1.11 uM | 24 h | -0.25 | -1.06 | 0.26 | -0.29 | -0.96 | 0.44 |
| 125329 | BRD-A49622760 | HEK293 | 0.37 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 125421 | BRD-A49622760 | MCF10A | 10 uM | 24 h | 0.21 | 0.89 | 0.02 | 0.0 | 0.0 | 0.0 |
| 125456 | BRD-A49622760 | MCF??7.00 | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.22 | 0.79 | 0.07 |
| 125553 | BRD-A49622760 | YAPC | 0.37 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 133369 | BRD-A49622760 | A549 | 0.25 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.24 | 0.87 | 0.17 |
| 133397 | BRD-A49622760 | HA1E | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 133432 | BRD-A49622760 | HELA | 0.74 uM | 24 h | 0.21 | 0.86 | 0.01 | 0.0 | 0.0 | 0.0 |
| 133462 | BRD-A49622760 | HT29 | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 133489 | BRD-A49622760 | JURKAT | 0.25 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 133564 | BRD-A49622760 | MDAMB231 | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.35 | -1.19 | 1.16 |
| 133589 | BRD-A49622760 | PC3 | 0.03 uM | 24 h | -0.27 | -1.13 | 0.41 | 0.0 | 0.0 | 0.0 |
| 133610 | BRD-A49622760 | THP1 | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |