CMap Candidate Details
Structure:
| CMap ID: | C00215 |
| Pert ID: | BRD-A17745711 |
| Compound Name: | alpha-methylserotonin |
| Targets: | HTR1D|HTR1E|HTR1F|HTR2A|HTR2B|HTR2C|HTR4 |
| MoA: | serotonin receptor agonist |
| SMILES: | CC(N)Cc1c[nH]c2ccc(O)cc12 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 98481 | BRD-A17745711 | NEU | 10 uM | 6 h | 0.28 | 1.18 | 0.39 | -0.38 | -1.28 | 1.44 |
| 98650 | BRD-A17745711 | NPC | 10 uM | 6 h | -0.24 | -1.0 | 0.14 | -0.26 | -0.87 | 0.23 |