CMap Candidate Details
Structure:
| CMap ID: | C02151 |
| Pert ID: | BRD-K16803204 |
| Compound Name: | filgotinib |
| Targets: | JAK1|JAK2|JAK3|TYK2 |
| MoA: | JAK inhibitor |
| SMILES: | O=C(Nc1nc2cccc(-c3ccc(CN4CCS(=O)(=O)CC4)cc3)n2n1)C1CC1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 90868 | BRD-K16803204 | MCF10A | 10 uM | 3 h | -0.24 | -1.01 | 0.16 | -0.35 | -1.18 | 1.15 |
| 95380 | BRD-K16803204 | MCF??7.00 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 95413 | BRD-K16803204 | U2OS | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 120244 | BRD-K16803204 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 120281 | BRD-K16803204 | A549 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.32 | 1.12 | 0.77 |
| 120318 | BRD-K16803204 | HA1E | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 120344 | BRD-K16803204 | HELA | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 120439 | BRD-K16803204 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.26 | -0.88 | 0.26 |
| 120477 | BRD-K16803204 | YAPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 128949 | BRD-K16803204 | HT29 | 0.03 uM | 24 h | 0.23 | 0.95 | 0.06 | 0.2 | 0.69 | 0.01 |