CMap Candidate Details
Structure:
| CMap ID: | C02199 |
| Pert ID: | BRD-K94353609 |
| Compound Name: | fluocinolone-acetonide |
| Targets: | NR3C1|SERPINA6 |
| MoA: | glucocorticoid receptor agonist |
| SMILES: | CC1(C)O[C@@H]2C[C@H]3[C@@H]4C[C@H](F)C5=CC(=O)C=C[C@]5(C)[C@@]4(F)[C@@H](O)C[C@]3(C)[C@@]2(O1)C(=O)CO |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 50083 | BRD-K94353609 | A549 | 10 uM | 6 h | 0.25 | 1.03 | 0.14 | 0.0 | 0.0 | 0.0 |
| 50268 | BRD-K94353609 | HA1E | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 50437 | BRD-K94353609 | HCC515 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.37 | -1.25 | 1.35 |
| 91357 | BRD-K94353609 | HUH7 | 8 uM | 72 h | 0.34 | 1.4 | 1.03 | -0.27 | -0.9 | 0.28 |