CMap Candidate Details
Structure:
| CMap ID: | C02212 |
| Pert ID: | BRD-A86044036 |
| Compound Name: | flurbiprofen-(+/-) |
| Targets: | PTGS1|PTGS2 |
| MoA: | cyclooxygenase inhibitor |
| SMILES: | CC(C(O)=O)c1ccc(c(F)c1)-c1ccccc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 24398 | BRD-A86044036 | A375 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 24647 | BRD-A86044036 | A549 | 10 uM | 6 h | -0.28 | -1.16 | 0.45 | -0.37 | -1.26 | 1.35 |
| 24858 | BRD-A86044036 | HT29 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.32 | -1.08 | 0.81 |
| 25078 | BRD-A86044036 | MCF??7.00 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.34 | -1.14 | 1.03 |
| 25138 | BRD-A86044036 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 50995 | BRD-A86044036 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 91349 | BRD-A86044036 | HUH7 | 12.5 uM | 72 h | 0.22 | 0.91 | 0.04 | -0.27 | -0.9 | 0.28 |
| 100369 | BRD-A86044036 | U2OS | 10 uM | 6 h | -0.3 | -1.26 | 0.72 | 0.28 | 0.99 | 0.4 |