CMap Candidate Details
Structure:
| CMap ID: | C02266 |
| Pert ID: | BRD-A85667082 |
| Compound Name: | fulvestrant |
| Targets: | ESR1|ESR2|GPER1 |
| MoA: | estrogen receptor antagonist |
| SMILES: | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)[C@H](CCCCCCCCCS(=O)CCCC(F)(F)C(F)(F)F)Cc1cc(O)ccc31 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 91460 | BRD-A85667082 | HUH7 | 6.66 uM | 72 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 104249 | BRD-A85667082 | U2OS | 20 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.25 | 0.89 | 0.2 |
| 116292 | BRD-A85667082 | A375 | 0.125 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 116334 | BRD-A85667082 | A549 | 10 uM | 24 h | -0.32 | -1.33 | 0.9 | 0.0 | 0.0 | 0.0 |
| 116375 | BRD-A85667082 | HA1E | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.29 | -0.97 | 0.46 |
| 116422 | BRD-A85667082 | HCC515 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 116474 | BRD-A85667082 | HEPG2 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.35 | -1.19 | 1.16 |
| 116524 | BRD-A85667082 | HT29 | 10 uM | 24 h | 0.17 | 0.69 | 0.0 | 0.0 | 0.0 | 0.0 |
| 116571 | BRD-A85667082 | MCF??7.00 | 0.125 uM | 24 h | -0.24 | -1.01 | 0.16 | -0.39 | -1.32 | 1.71 |
| 116610 | BRD-A85667082 | PC3 | 10 uM | 24 h | 0.29 | 1.21 | 0.47 | 0.0 | 0.0 | 0.0 |