CMap Candidate Details
Structure:
| CMap ID: | C00228 |
| Pert ID: | BRD-K67043667 |
| Compound Name: | altretamine |
| Targets: | |
| MoA: | DNA synthesis inhibitor |
| SMILES: | CN(C)c1nc(nc(n1)N(C)C)N(C)C |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 5668 | BRD-K67043667 | HCC515 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 5947 | BRD-K67043667 | HEPG2 | 10 uM | 6 h | -0.28 | -1.15 | 0.44 | 0.0 | 0.0 | 0.0 |
| 6360 | BRD-K67043667 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.32 | -1.09 | 0.82 |
| 39739 | BRD-K67043667 | ASC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 40846 | BRD-K67043667 | NEU | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 41156 | BRD-K67043667 | NPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.29 | 1.01 | 0.45 |
| 41494 | BRD-K67043667 | SKB | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 91320 | BRD-K67043667 | HUH7 | 15 uM | 72 h | 0.26 | 1.1 | 0.24 | 0.0 | 0.0 | 0.0 |
| 99361 | BRD-K67043667 | U2OS | 10 uM | 6 h | -0.22 | -0.91 | 0.05 | 0.3 | 1.08 | 0.65 |
| 124621 | BRD-K67043667 | HA1E | 3.33 uM | 24 h | -0.28 | -1.15 | 0.44 | -0.25 | -0.83 | 0.16 |
| 124666 | BRD-K67043667 | HELA | 0.125 uM | 24 h | -0.22 | -0.93 | 0.07 | -0.29 | -0.99 | 0.51 |
| 124698 | BRD-K67043667 | HT29 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 124729 | BRD-K67043667 | JURKAT | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 124804 | BRD-K67043667 | MDAMB231 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 124845 | BRD-K67043667 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.21 | 0.76 | 0.05 |
| 124887 | BRD-K67043667 | THP1 | 10 uM | 24 h | 0.23 | 0.95 | 0.06 | 0.0 | 0.0 | 0.0 |
| 132667 | BRD-K67043667 | A375 | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 132694 | BRD-K67043667 | A549 | 0.03 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.26 | 0.92 | 0.25 |
| 132760 | BRD-K67043667 | HEK293 | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 132876 | BRD-K67043667 | MCF10A | 0.01 uM | 24 h | -0.26 | -1.07 | 0.27 | 0.0 | 0.0 | 0.0 |
| 132904 | BRD-K67043667 | MCF??7.00 | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.3 | -1.01 | 0.57 |
| 132958 | BRD-K67043667 | YAPC | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |