CMap Candidate Details
Structure:
| CMap ID: | C02360 |
| Pert ID: | BRD-A61154809 |
| Compound Name: | gliclazide |
| Targets: | ABCC8|VEGFA |
| MoA: | ATP channel blocker; insulin secretagogue |
| SMILES: | Cc1ccc(cc1)S(=O)(=O)NC(=O)NN1CC2CCCC2C1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 91399 | BRD-A61154809 | HUH7 | 10 uM | 72 h | -0.21 | -0.86 | 0.02 | 0.0 | 0.0 | 0.0 |
| 100247 | BRD-A61154809 | U2OS | 10 uM | 6 h | -0.23 | -0.94 | 0.08 | 0.28 | 0.98 | 0.36 |
| 123819 | BRD-A61154809 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 123860 | BRD-A61154809 | A549 | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 123929 | BRD-A61154809 | HEK293 | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 124031 | BRD-A61154809 | JURKAT | 1.11 uM | 24 h | -0.23 | -0.95 | 0.09 | 0.0 | 0.0 | 0.0 |
| 124082 | BRD-A61154809 | MCF10A | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 124109 | BRD-A61154809 | MCF??7.00 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 124146 | BRD-A61154809 | MDAMB231 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.29 | 1.04 | 0.56 |
| 124159 | BRD-A61154809 | PC3 | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 124212 | BRD-A61154809 | THP1 | 1.11 uM | 24 h | -0.22 | -0.92 | 0.06 | 0.0 | 0.0 | 0.0 |
| 124265 | BRD-A61154809 | YAPC | 3.33 uM | 24 h | -0.17 | -0.7 | 0.0 | 0.0 | 0.0 | 0.0 |
| 132182 | BRD-A61154809 | HA1E | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 132214 | BRD-A61154809 | HELA | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.36 | 1.26 | 1.29 |
| 132245 | BRD-A61154809 | HT29 | 0.25 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |