CMap Candidate Details
Structure:
| CMap ID: | C00239 |
| Pert ID: | BRD-K06854232 |
| Compound Name: | AM-580 |
| Targets: | RARA |
| MoA: | retinoid receptor agonist |
| SMILES: | CC1(C)CCC(C)(C)c2cc(ccc12)C(=O)Nc1ccc(cc1)C(O)=O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 1196 | BRD-K06854232 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 4349 | BRD-K06854232 | HCC515 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.31 | -1.03 | 0.65 |
| 4883 | BRD-K06854232 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 9349 | BRD-K06854232 | AGS | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 9655 | BRD-K06854232 | H1299 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 9932 | BRD-K06854232 | HA1E | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.33 | -1.12 | 0.94 |
| 10720 | BRD-K06854232 | HEPG2 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.31 | 1.08 | 0.66 |
| 10936 | BRD-K06854232 | HT29 | 10 uM | 24 h | -0.33 | -1.39 | 1.09 | -0.39 | -1.3 | 1.65 |
| 11188 | BRD-K06854232 | MCF??7.00 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 11406 | BRD-K06854232 | NCIH2073 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 12256 | BRD-K06854232 | NOMO1 | 10 uM | 6 h | -0.28 | -1.16 | 0.45 | 0.0 | 0.0 | 0.0 |
| 12721 | BRD-K06854232 | SW480 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 13026 | BRD-K06854232 | THP1 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.29 | 1.04 | 0.56 |
| 13200 | BRD-K06854232 | U937 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.22 | -0.76 | 0.07 |
| 44836 | BRD-K06854232 | ASC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 46270 | BRD-K06854232 | PHH | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 46585 | BRD-K06854232 | SKB | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 90529 | BRD-K06854232 | A549 | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 96333 | BRD-K06854232 | A375 | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 97693 | BRD-K06854232 | NKDBA | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 98742 | BRD-K06854232 | NPC | 10 uM | 24 h | -0.17 | -0.73 | 0.0 | 0.0 | 0.0 | 0.0 |
| 98864 | BRD-K06854232 | NEU | 10 uM | 24 h | 0.18 | 0.75 | 0.0 | 0.0 | 0.0 | 0.0 |
| 100016 | BRD-K06854232 | U2OS | 10 uM | 6 h | 0.24 | 0.98 | 0.09 | 0.0 | 0.0 | 0.0 |