CMap Candidate Details
Structure:
| CMap ID: | C02511 |
| Pert ID: | BRD-A51964809 |
| Compound Name: | halofantrine |
| Targets: | KCNH2|KCNN4 |
| MoA: | antimalarial agent |
| SMILES: | CCCCN(CCCC)CCC(O)c1cc2c(Cl)cc(Cl)cc2c2cc(ccc12)C(F)(F)F |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 121575 | BRD-A51964809 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 121623 | BRD-A51964809 | HA1E | 10 uM | 24 h | 0.2 | 0.82 | 0.0 | 0.0 | 0.0 | 0.0 |
| 121669 | BRD-A51964809 | HT29 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.28 | 0.98 | 0.36 |
| 121693 | BRD-A51964809 | MCF??7.00 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 121716 | BRD-A51964809 | YAPC | 1.11 uM | 24 h | 0.28 | 1.18 | 0.39 | 0.31 | 1.1 | 0.7 |
| 129618 | BRD-A51964809 | HELA | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129710 | BRD-A51964809 | PC3 | 0.25 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.37 | 1.3 | 1.59 |