CMap Candidate Details
Structure:
| CMap ID: | C02555 |
| Pert ID: | BRD-A74975734 |
| Compound Name: | homatropine |
| Targets: | CES1|CHRM1 |
| MoA: | acetylcholine receptor antagonist |
| SMILES: | CN1[C@H]2CC[C@@H]1C[C@@H](C2)OC(=O)C(O)c1ccccc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 6690 | BRD-A74975734 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.27 | 0.97 | 0.35 |
| 7112 | BRD-A74975734 | A549 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 7262 | BRD-A74975734 | HA1E | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 7805 | BRD-A74975734 | HT29 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 8244 | BRD-A74975734 | MCF??7.00 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.42 | -1.42 | 2.02 |
| 8470 | BRD-A74975734 | PC3 | 10 uM | 6 h | -0.19 | -0.81 | 0.0 | 0.0 | 0.0 | 0.0 |
| 8620 | BRD-A74975734 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.22 | -0.73 | 0.04 |