CMap Candidate Details
Structure:
| CMap ID: | C00258 |
| Pert ID: | BRD-K64925568 |
| Compound Name: | AMG-232 |
| Targets: | MDM2 |
| MoA: | MDM inhibitor |
| SMILES: | CC(C)[C@@H](CS(=O)(=O)C(C)C)N1[C@@H]([C@H](C[C@](C)(CC(O)=O)C1=O)c1cccc(Cl)c1)c1ccc(Cl)cc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 1282 | BRD-K64925568 | MCF??7.00 | 10 uM | 48 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 1381 | BRD-K64925568 | U2OS | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 124941 | BRD-K64925568 | A375 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 125004 | BRD-K64925568 | HA1E | 0.04 uM | 24 h | 0.3 | 1.26 | 0.58 | -0.26 | -0.88 | 0.25 |
| 125034 | BRD-K64925568 | HELA | 10 uM | 24 h | -0.29 | -1.21 | 0.58 | -0.26 | -0.87 | 0.24 |
| 125116 | BRD-K64925568 | MDAMB231 | 0.04 uM | 24 h | -0.24 | -1.0 | 0.14 | 0.0 | 0.0 | 0.0 |
| 125134 | BRD-K64925568 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 125173 | BRD-K64925568 | THP1 | 10 uM | 24 h | -0.26 | -1.06 | 0.26 | 0.0 | 0.0 | 0.0 |
| 125214 | BRD-K64925568 | YAPC | 10 uM | 24 h | 0.21 | 0.86 | 0.01 | -0.32 | -1.06 | 0.75 |
| 132999 | BRD-K64925568 | A549 | 2.22 uM | 24 h | -0.32 | -1.34 | 0.98 | -0.26 | -0.88 | 0.25 |
| 133061 | BRD-K64925568 | HEK293 | 0.03 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.36 | -1.22 | 1.25 |
| 133123 | BRD-K64925568 | HT29 | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 133168 | BRD-K64925568 | JURKAT | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.29 | -0.97 | 0.46 |
| 133203 | BRD-K64925568 | MCF10A | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |