CMap Candidate Details
Structure:
| CMap ID: | C02582 |
| Pert ID: | BRD-A06390036 |
| Compound Name: | hydroquinidine |
| Targets: | |
| MoA: | antiarrhythmic |
| SMILES: | CC[C@H]1CN2CCC1C[C@@H]2[C@@H](O)c1ccnc2ccc(OC)cc12 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 4001 | BRD-A06390036 | HA1E | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 4270 | BRD-A06390036 | HCC515 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 4605 | BRD-A06390036 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 4831 | BRD-A06390036 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 37038 | BRD-A06390036 | A375 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.35 | -1.19 | 1.15 |
| 37212 | BRD-A06390036 | A549 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 37434 | BRD-A06390036 | ASC | 10 uM | 24 h | -0.3 | -1.24 | 0.65 | -0.26 | -0.86 | 0.22 |
| 37975 | BRD-A06390036 | HT29 | 10 uM | 6 h | -0.26 | -1.07 | 0.28 | -0.24 | -0.8 | 0.12 |
| 38126 | BRD-A06390036 | MCF??7.00 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 38288 | BRD-A06390036 | NPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 38597 | BRD-A06390036 | PHH | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.27 | -0.91 | 0.31 |
| 38813 | BRD-A06390036 | SKB | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |