CMap Candidate Details
Structure:
| CMap ID: | C02631 |
| Pert ID: | BRD-K94455792 |
| Compound Name: | ICG-001 |
| Targets: | CTNNB1 |
| MoA: | beta-catenin inhibitor |
| SMILES: | Oc1ccc(C[C@H]2N3[C@H](CN(Cc4cccc5ccccc45)C2=O)N(CCC3=O)C(=O)NCc2ccccc2)cc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 90812 | BRD-K94455792 | MCF10A | 1.11 uM | 24 h | 0.25 | 1.03 | 0.13 | 0.0 | 0.0 | 0.0 |