CMap Candidate Details
Structure:
| CMap ID: | C02633 |
| Pert ID: | BRD-K11071038 |
| Compound Name: | ICI-162846 |
| Targets: | HRH2 |
| MoA: | histamine receptor antagonist |
| SMILES: | NC(=O)CCCCn1ccc(n1)\N=C(/N)NCC(F)(F)F |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 121201 | BRD-K11071038 | A549 | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 121235 | BRD-K11071038 | HA1E | 3.33 uM | 24 h | -0.24 | -1.0 | 0.15 | 0.0 | 0.0 | 0.0 |
| 121327 | BRD-K11071038 | PC3 | 0.37 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129250 | BRD-K11071038 | A375 | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.29 | -0.99 | 0.5 |
| 129281 | BRD-K11071038 | HELA | 2.22 uM | 3 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129314 | BRD-K11071038 | HT29 | 0.25 uM | 24 h | 0.32 | 1.32 | 0.78 | -0.38 | -1.28 | 1.45 |
| 129347 | BRD-K11071038 | MCF??7.00 | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129385 | BRD-K11071038 | YAPC | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.32 | -1.07 | 0.76 |