CMap Candidate Details
Structure:
| CMap ID: | C02653 |
| Pert ID: | BRD-K37516142 |
| Compound Name: | idebenone |
| Targets: | |
| MoA: | calcium channel modulator |
| SMILES: | COC1=C(OC)C(=O)C(CCCCCCCCCCO)=C(C)C1=O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 24574 | BRD-K37516142 | A549 | 10 uM | 24 h | 0.27 | 1.11 | 0.26 | 0.0 | 0.0 | 0.0 |
| 25361 | BRD-K37516142 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 90959 | BRD-K37516142 | HUH7 | 10 uM | 72 h | 0.24 | 1.0 | 0.1 | 0.26 | 0.91 | 0.23 |
| 121718 | BRD-K37516142 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 121733 | BRD-K37516142 | HA1E | 10 uM | 24 h | -0.29 | -1.19 | 0.54 | 0.0 | 0.0 | 0.0 |
| 121788 | BRD-K37516142 | HT29 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.22 | 0.78 | 0.06 |
| 121838 | BRD-K37516142 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 121866 | BRD-K37516142 | YAPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129817 | BRD-K37516142 | HEK293 | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.2 | -0.68 | 0.02 |
| 129867 | BRD-K37516142 | HELA | 0.03 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129944 | BRD-K37516142 | MCF10A | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.24 | -0.82 | 0.15 |
| 129992 | BRD-K37516142 | MCF??7.00 | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.25 | -0.85 | 0.2 |
| 130028 | BRD-K37516142 | MDAMB231 | 0.03 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.22 | 0.78 | 0.07 |
| 130100 | BRD-K37516142 | THP1 | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.22 | 0.77 | 0.06 |