CMap Candidate Details
Structure:
| CMap ID: | C02671 |
| Pert ID: | BRD-K48722833 |
| Compound Name: | iloperidone |
| Targets: | ADRA1A|ADRA2C|DRD1|DRD2|DRD3|DRD4|HRH1|HTR1A|HTR2A|HTR6|HTR7 |
| MoA: | dopamine receptor antagonist; serotonin receptor antagonist |
| SMILES: | COc1cc(ccc1OCCCN1CCC(CC1)c1noc2cc(F)ccc12)C(C)=O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 33565 | BRD-K48722833 | A375 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 34117 | BRD-K48722833 | ASC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.29 | 1.04 | 0.53 |
| 34632 | BRD-K48722833 | HCC515 | 10 uM | 6 h | 0.21 | 0.89 | 0.02 | 0.0 | 0.0 | 0.0 |
| 34897 | BRD-K48722833 | HEPG2 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.37 | 1.3 | 1.53 |
| 35156 | BRD-K48722833 | HT29 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 35393 | BRD-K48722833 | MCF??7.00 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 35792 | BRD-K48722833 | NPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.38 | -1.27 | 1.39 |
| 36086 | BRD-K48722833 | PC3 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 36277 | BRD-K48722833 | PHH | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 36575 | BRD-K48722833 | SKB | 10 uM | 24 h | 0.23 | 0.97 | 0.08 | 0.24 | 0.86 | 0.15 |
| 36827 | BRD-K48722833 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.43 | 1.52 | 2.28 |
| 96149 | BRD-K48722833 | A549 | 10 uM | 24 h | -0.29 | -1.2 | 0.55 | 0.0 | 0.0 | 0.0 |