CMap Candidate Details
Structure:
| CMap ID: | C00287 |
| Pert ID: | BRD-K97799481 |
| Compound Name: | aminophylline |
| Targets: | ADORA1|ADORA2A|ADORA2B|ADORA3|HDAC2|PDE3A|PDE3B|PDE4A|PDE4B|PDE4C|PDE4D |
| MoA: | adenosine receptor antagonist |
| SMILES: | Cn1c2nc[nH]c2c(=O)n(C)c1=O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 50440 | BRD-K97799481 | HCC515 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 52219 | BRD-K97799481 | MCF??7.00 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 52756 | BRD-K97799481 | HEPG2 | 4 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 90904 | BRD-K97799481 | HUH7 | 20 uM | 72 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 127337 | BRD-K97799481 | A375 | 0.37 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.23 | -0.76 | 0.07 |
| 127382 | BRD-K97799481 | A549 | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.33 | 1.16 | 0.91 |
| 127411 | BRD-K97799481 | HA1E | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.23 | -0.76 | 0.07 |
| 127498 | BRD-K97799481 | JURKAT | 0.37 uM | 24 h | -0.25 | -1.04 | 0.21 | 0.0 | 0.0 | 0.0 |
| 127592 | BRD-K97799481 | PC3 | 0.125 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 127635 | BRD-K97799481 | THP1 | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 127668 | BRD-K97799481 | YAPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.31 | 1.09 | 0.68 |
| 135359 | BRD-K97799481 | HELA | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.37 | -1.26 | 1.35 |
| 135388 | BRD-K97799481 | HT29 | 0.25 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.28 | -0.93 | 0.34 |
| 135428 | BRD-K97799481 | MCF10A | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |