CMap Candidate Details
Structure:
| CMap ID: | C02888 |
| Pert ID: | BRD-K02898090 |
| Compound Name: | kifunensine |
| Targets: | MAN1B1|MAN2A1 |
| MoA: | mannosidase inhibitor |
| SMILES: | OC[C@@H]1[C@@H](O)[C@H](O)[C@H](O)[C@H]2NC(=O)C(=O)N12 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 98002 | BRD-K02898090 | HA1E | 10 uM | 24 h | -0.29 | -1.23 | 0.62 | 0.0 | 0.0 | 0.0 |
| 98035 | BRD-K02898090 | MCF??7.00 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.28 | -0.96 | 0.42 |
| 98084 | BRD-K02898090 | P1A82 | 10 uM | 24 h | -0.21 | -0.89 | 0.03 | 0.3 | 1.07 | 0.61 |