CMap Candidate Details
Structure:
| CMap ID: | C02949 |
| Pert ID: | BRD-A85472596 |
| Compound Name: | L-670596 |
| Targets: | |
| MoA: | prostanoid receptor antagonist |
| SMILES: | CS(=O)(=O)c1ccc(Cn2c3C(CC(O)=O)CCCc3c3cc(F)cc(F)c23)cc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 6857 | BRD-A85472596 | A375 | 10 uM | 6 h | -0.23 | -0.96 | 0.09 | 0.21 | 0.73 | 0.03 |
| 7125 | BRD-A85472596 | A549 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 7818 | BRD-A85472596 | HT29 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.31 | -1.04 | 0.68 |
| 8227 | BRD-A85472596 | MCF??7.00 | 10 uM | 6 h | -0.2 | -0.83 | 0.0 | 0.2 | 0.71 | 0.02 |
| 8337 | BRD-A85472596 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 8632 | BRD-A85472596 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 100367 | BRD-A85472596 | U2OS | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |