CMap Candidate Details
Structure:
| CMap ID: | C02953 |
| Pert ID: | BRD-K18816859 |
| Compound Name: | L-694247 |
| Targets: | HTR1A|HTR1B|HTR1D |
| MoA: | serotonin receptor agonist |
| SMILES: | CS(=O)(=O)Nc1ccc(Cc2noc(n2)-c2ccc3[nH]cc(CCN)c3c2)cc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 2991 | BRD-K18816859 | HA1E | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 3340 | BRD-K18816859 | HCC515 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 3739 | BRD-K18816859 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 22257 | BRD-K18816859 | A549 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 23826 | BRD-K18816859 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 44333 | BRD-K18816859 | A375 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 44890 | BRD-K18816859 | ASC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 45192 | BRD-K18816859 | HEPG2 | 10 uM | 6 h | -0.2 | -0.82 | 0.0 | 0.0 | 0.0 | 0.0 |
| 45460 | BRD-K18816859 | HT29 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 45668 | BRD-K18816859 | MCF??7.00 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 46008 | BRD-K18816859 | NPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.42 | -1.43 | 15.35 |
| 46325 | BRD-K18816859 | PHH | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.3 | -1.01 | 0.57 |
| 46641 | BRD-K18816859 | SKB | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |