CMap Candidate Details
Structure:
| CMap ID: | C02966 |
| Pert ID: | BRD-K43586850 |
| Compound Name: | lacidipine |
| Targets: | CACNA1C |
| MoA: | calcium channel blocker |
| SMILES: | CCOC(=O)C1=C(C)NC(C)=C(C1c1ccccc1\C=C\C(=O)OC(C)(C)C)C(=O)OCC |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 91102 | BRD-K43586850 | HUH7 | 6.66 uM | 72 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 95527 | BRD-K43586850 | A549 | 10 uM | 48 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 95595 | BRD-K43586850 | MCF??7.00 | 10 uM | 48 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 95720 | BRD-K43586850 | U2OS | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 121581 | BRD-K43586850 | HA1E | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 121627 | BRD-K43586850 | HELA | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 121652 | BRD-K43586850 | HT29 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 121695 | BRD-K43586850 | YAPC | 0.125 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129576 | BRD-K43586850 | A375 | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129674 | BRD-K43586850 | PC3 | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.31 | 1.09 | 0.67 |