CMap Candidate Details
Structure:
| CMap ID: | C02993 |
| Pert ID: | BRD-K20008181 |
| Compound Name: | LCQ908 |
| Targets: | DGAT1 |
| MoA: | diacylglycerol O acyltransferase inhibitor |
| SMILES: | OC(=O)C[C@H]1CC[C@@H](CC1)c1ccc(cc1)-c1ccc(Nc2ccc(nc2)C(F)(F)F)cn1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 121405 | BRD-K20008181 | HELA | 0.37 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.27 | 0.97 | 0.35 |
| 121508 | BRD-K20008181 | YAPC | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.25 | -0.86 | 0.21 |
| 129402 | BRD-K20008181 | A375 | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.25 | -0.85 | 0.2 |
| 129432 | BRD-K20008181 | HA1E | 0.25 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129489 | BRD-K20008181 | HT29 | 2.22 uM | 24 h | -0.21 | -0.89 | 0.04 | -0.21 | -0.7 | 0.03 |
| 129519 | BRD-K20008181 | MCF??7.00 | 0.03 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129552 | BRD-K20008181 | PC3 | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |