CMap Candidate Details
Structure:
| CMap ID: | C03013 |
| Pert ID: | BRD-K94288301 |
| Compound Name: | letermovir |
| Targets: | |
| MoA: | CMV terminase inhibitor |
| SMILES: | COc1cccc(c1)N1CCN(CC1)C1=Nc2c(F)cccc2[C@H](CC(O)=O)N1c1cc(ccc1OC)C(F)(F)F |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 128115 | BRD-K94288301 | A375 | 0.37 uM | 24 h | -0.24 | -0.98 | 0.13 | 0.0 | 0.0 | 0.0 |
| 128145 | BRD-K94288301 | A549 | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 128172 | BRD-K94288301 | HEK293 | 10 uM | 24 h | 0.21 | 0.9 | 0.02 | -0.25 | -0.83 | 0.16 |
| 128234 | BRD-K94288301 | MCF10A | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.3 | 1.06 | 0.58 |
| 128313 | BRD-K94288301 | MDAMB231 | 0.37 uM | 24 h | 0.17 | 0.73 | 0.0 | 0.0 | 0.0 | 0.0 |
| 128335 | BRD-K94288301 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.33 | -1.12 | 0.96 |
| 128358 | BRD-K94288301 | THP1 | 10 uM | 24 h | -0.29 | -1.22 | 0.62 | -0.27 | -0.92 | 0.32 |
| 135818 | BRD-K94288301 | HA1E | 0.74 uM | 24 h | 0.24 | 1.0 | 0.1 | 0.0 | 0.0 | 0.0 |
| 135908 | BRD-K94288301 | HELA | 0.25 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 135949 | BRD-K94288301 | HT29 | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 135997 | BRD-K94288301 | JURKAT | 0.03 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 136033 | BRD-K94288301 | MCF??7.00 | 0.01 uM | 24 h | 0.21 | 0.87 | 0.01 | 0.0 | 0.0 | 0.0 |
| 136143 | BRD-K94288301 | YAPC | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |