CMap Candidate Details
Structure:
| CMap ID: | C03027 |
| Pert ID: | BRD-K31812033 |
| Compound Name: | levobunolol |
| Targets: | ADRB1|ADRB2|ADRB3 |
| MoA: | adrenergic receptor antagonist |
| SMILES: | CC(C)(C)NC[C@H](O)COc1cccc2C(=O)CCCc12 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 99834 | BRD-K31812033 | U2OS | 6.66 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 120547 | BRD-K31812033 | A549 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.26 | 0.92 | 0.25 |
| 120591 | BRD-K31812033 | HA1E | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 120616 | BRD-K31812033 | HELA | 0.37 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 120648 | BRD-K31812033 | HT29 | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.37 | -1.26 | 1.36 |
| 120698 | BRD-K31812033 | JURKAT | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 120770 | BRD-K31812033 | PC3 | 1.11 uM | 24 h | 0.3 | 1.25 | 0.54 | 0.0 | 0.0 | 0.0 |
| 120804 | BRD-K31812033 | YAPC | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.32 | -1.06 | 0.73 |
| 128986 | BRD-K31812033 | A375 | 0.01 uM | 24 h | -0.23 | -0.95 | 0.09 | -0.36 | -1.21 | 1.24 |
| 129049 | BRD-K31812033 | MCF??7.00 | 0.74 uM | 24 h | 0.23 | 0.97 | 0.08 | -0.25 | -0.85 | 0.2 |