CMap Candidate Details
Structure:
| CMap ID: | C03028 |
| Pert ID: | BRD-K73323637 |
| Compound Name: | levobunolol-(+) |
| Targets: | |
| MoA: | adrenergic receptor antagonist |
| SMILES: | CC(C)(C)NC[C@@H](O)COc1cccc2C(=O)CCCc12 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 52192 | BRD-K73323637 | MCF??7.00 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 52332 | BRD-K73323637 | PC3 | 10 uM | 24 h | -0.21 | -0.89 | 0.04 | -0.26 | -0.88 | 0.25 |
| 99445 | BRD-K73323637 | U2OS | 6.66 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |