CMap Candidate Details
Structure:
| CMap ID: | C03146 |
| Pert ID: | BRD-K54520417 |
| Compound Name: | LXR-623 |
| Targets: | AR|NR1H2|NR1H3|NR1I2|NR3C1 |
| MoA: | LXR agonist |
| SMILES: | Fc1ccc(cc1)-c1n(Cc2ccc(F)cc2Cl)nc2c(cccc12)C(F)(F)F |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 121569 | BRD-K54520417 | A375 | 0.125 uM | 24 h | -0.21 | -0.88 | 0.03 | 0.0 | 0.0 | 0.0 |
| 121611 | BRD-K54520417 | HA1E | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.44 | -1.48 | 15.35 |
| 121644 | BRD-K54520417 | HELA | 0.125 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 121664 | BRD-K54520417 | HT29 | 0.125 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 121687 | BRD-K54520417 | MCF??7.00 | 0.37 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129700 | BRD-K54520417 | PC3 | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129733 | BRD-K54520417 | YAPC | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |