CMap Candidate Details
Structure:
| CMap ID: | C03154 |
| Pert ID: | BRD-K93331255 |
| Compound Name: | lypressin |
| Targets: | AVPR1A|AVPR1B|AVPR2 |
| MoA: | vasopressin receptor agonist |
| SMILES: | NCCCC[C@H](NC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CSSC[C@H](N)C(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(N)=O)C(=O)N1)C(=O)NCC(N)=O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 33703 | BRD-K93331255 | A375 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.27 | -0.93 | 0.34 |
| 33858 | BRD-K93331255 | A549 | 10 uM | 24 h | 0.26 | 1.08 | 0.22 | -0.31 | -1.06 | 0.73 |
| 34212 | BRD-K93331255 | ASC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.32 | -1.06 | 0.73 |
| 34447 | BRD-K93331255 | HA1E | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 34993 | BRD-K93331255 | HEPG2 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 35229 | BRD-K93331255 | HT29 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.24 | 0.85 | 0.14 |
| 35476 | BRD-K93331255 | MCF??7.00 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.29 | -0.99 | 0.51 |
| 35639 | BRD-K93331255 | NEU | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 35867 | BRD-K93331255 | NPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.26 | -0.86 | 0.22 |
| 36013 | BRD-K93331255 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.28 | 0.98 | 0.37 |
| 36384 | BRD-K93331255 | PHH | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.2 | -0.67 | 0.01 |
| 36685 | BRD-K93331255 | SKB | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.39 | -1.32 | 1.71 |
| 36896 | BRD-K93331255 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.24 | -0.79 | 0.11 |