CMap Candidate Details
Structure:
| CMap ID: | C03464 |
| Pert ID: | BRD-K61695967 |
| Compound Name: | MKT-077 |
| Targets: | |
| MoA: | HSP inhibitor |
| SMILES: | CCn1\c(=C/c2cccc[n+]2CC)s\c(=C2\Sc3ccccc3N2C)c1=O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|