CMap Candidate Details
Structure:
| CMap ID: | C03468 |
| Pert ID: | BRD-K77547509 |
| Compound Name: | ML-179 |
| Targets: | NR5A2 |
| MoA: | liver receptor homolog inverse agonist |
| SMILES: | FC(F)(F)c1cccc(c1)N1CCN(CC1)c1cc(=O)n(C2CCCCC2)c(=O)[nH]1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 16483 | BRD-K77547509 | A375 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.27 | -0.9 | 0.29 |
| 16772 | BRD-K77547509 | A549 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.28 | -0.95 | 0.41 |
| 17103 | BRD-K77547509 | HCC515 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.31 | -1.04 | 0.66 |
| 17437 | BRD-K77547509 | HEPG2 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 17780 | BRD-K77547509 | HT29 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.23 | -0.76 | 0.07 |
| 18045 | BRD-K77547509 | MCF??7.00 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.33 | 1.16 | 0.9 |
| 18502 | BRD-K77547509 | PC3 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 18622 | BRD-K77547509 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |