CMap Candidate Details
Structure:
| CMap ID: | C00347 |
| Pert ID: | BRD-K45724504 |
| Compound Name: | anguidine |
| Targets: | SLC5A1 |
| MoA: | protein synthesis inhibitor |
| SMILES: | CC(=O)OC[C@]12CCC(C)=C[C@H]1O[C@@H]1[C@H](O)[C@@H](OC(C)=O)[C@@]2(C)[C@@]11CO1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 1203 | BRD-K45724504 | PC3 | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 1253 | BRD-K45724504 | A549 | 0.12 uM | 48 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 1294 | BRD-K45724504 | MCF??7.00 | 10 uM | 48 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 1327 | BRD-K45724504 | U2OS | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |