CMap Candidate Details
Structure:
| CMap ID: | C03524 |
| Pert ID: | BRD-K21548250 |
| Compound Name: | moracizine |
| Targets: | SCN5A |
| MoA: | sodium channel blocker |
| SMILES: | CCOC(=O)Nc1ccc2Sc3ccccc3N(C(=O)CCN3CCOCC3)c2c1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 6980 | BRD-K21548250 | A549 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.34 | -1.14 | 1.01 |
| 7430 | BRD-K21548250 | HA1E | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 7637 | BRD-K21548250 | HCC515 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 7989 | BRD-K21548250 | HT29 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 8806 | BRD-K21548250 | VCAP | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.28 | 1.0 | 0.43 |
| 52137 | BRD-K21548250 | MCF??7.00 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 99745 | BRD-K21548250 | U2OS | 12 uM | 6 h | 0.25 | 1.03 | 0.14 | 0.34 | 1.2 | 1.11 |
| 121416 | BRD-K21548250 | HELA | 0.04 uM | 24 h | 0.21 | 0.86 | 0.01 | -0.26 | -0.87 | 0.22 |
| 121483 | BRD-K21548250 | PC3 | 10 uM | 24 h | -0.18 | -0.76 | 0.0 | 0.0 | 0.0 | 0.0 |
| 121523 | BRD-K21548250 | YAPC | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129409 | BRD-K21548250 | A375 | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |