CMap Candidate Details
Structure:
| CMap ID: | C03587 |
| Pert ID: | BRD-K93806173 |
| Compound Name: | N-MPPP |
| Targets: | |
| MoA: | opioid receptor agonist |
| SMILES: | CN([C@H](CN1CCCC1)c1ccccc1)C(=O)Cc1ccccc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 96337 | BRD-K93806173 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.34 | 1.2 | 1.11 |
| 96407 | BRD-K93806173 | PC3 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |