CMap Candidate Details
Structure:
| CMap ID: | C03608 |
| Pert ID: | BRD-K70898774 |
| Compound Name: | naloxone-benzoylhydrazone |
| Targets: | OPRK1|OPRM1 |
| MoA: | opioid receptor antagonist |
| SMILES: | Oc1ccc2C[C@H]3N(CC=C)CC[C@@]45[C@@H](Oc1c24)\C(CC[C@@]35O)=N\NC(=O)c1ccccc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 96355 | BRD-K70898774 | A375 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.31 | 1.11 | 0.72 |
| 96427 | BRD-K70898774 | PC3 | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |