CMap Candidate Details
Structure:
| CMap ID: | C03611 |
| Pert ID: | BRD-A47342814 |
| Compound Name: | naltrindole |
| Targets: | OPRD1|OPRK1|OPRM1 |
| MoA: | opioid receptor antagonist |
| SMILES: | Oc1ccc2CC3N(CC4CC4)CC[C@@]45[C@@H](Oc1c24)c1[nH]c2ccccc2c1C[C@@]35O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 24532 | BRD-A47342814 | A549 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 24725 | BRD-A47342814 | HA1E | 10 uM | 6 h | -0.23 | -0.97 | 0.11 | 0.0 | 0.0 | 0.0 |
| 24845 | BRD-A47342814 | HT29 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.26 | 0.92 | 0.25 |
| 25069 | BRD-A47342814 | MCF??7.00 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.3 | 1.04 | 0.56 |
| 25219 | BRD-A47342814 | PC3 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 25296 | BRD-A47342814 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |