CMap Candidate Details
Structure:
| CMap ID: | C03615 |
| Pert ID: | BRD-K52080565 |
| Compound Name: | nandrolone |
| Targets: | AR|CYP19A1|MAOA|MAOB |
| MoA: | imidazoline receptor agonist |
| SMILES: | C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@H]34)[C@@H]1CC[C@@H]2O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 24587 | BRD-K52080565 | A549 | 10 uM | 24 h | -0.23 | -0.96 | 0.1 | 0.0 | 0.0 | 0.0 |
| 25386 | BRD-K52080565 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 121562 | BRD-K52080565 | A375 | 10 uM | 24 h | 0.32 | 1.35 | 0.96 | -0.27 | -0.91 | 0.31 |
| 121600 | BRD-K52080565 | HA1E | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 121638 | BRD-K52080565 | HELA | 10 uM | 24 h | 0.19 | 0.77 | 0.0 | -0.31 | -1.06 | 0.73 |
| 121681 | BRD-K52080565 | MCF??7.00 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.25 | -0.85 | 0.2 |
| 121706 | BRD-K52080565 | YAPC | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129632 | BRD-K52080565 | HT29 | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.4 | 1.4 | 2.18 |
| 129691 | BRD-K52080565 | PC3 | 0.25 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |