CMap Candidate Details
Structure:
| CMap ID: | C03631 |
| Pert ID: | BRD-K44353683 |
| Compound Name: | nateglinide |
| Targets: | ABCC8|KCNJ10|KCNJ11|PPARG |
| MoA: | insulin secretagogue |
| SMILES: | CC(C)[C@H]1CC[C@@H](CC1)C(=O)N[C@H](Cc1ccccc1)C(O)=O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 25510 | BRD-K44353683 | VCAP | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 90908 | BRD-K44353683 | HUH7 | 10 uM | 72 h | 0.17 | 0.72 | 0.0 | -0.28 | -0.95 | 0.41 |
| 123255 | BRD-K44353683 | A375 | 0.04 uM | 24 h | 0.22 | 0.92 | 0.04 | 0.0 | 0.0 | 0.0 |
| 123378 | BRD-K44353683 | MCF10A | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 123385 | BRD-K44353683 | MCF??7.00 | 0.37 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 123443 | BRD-K44353683 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.3 | 1.07 | 0.63 |
| 123476 | BRD-K44353683 | THP1 | 0.04 uM | 24 h | 0.25 | 1.03 | 0.13 | 0.0 | 0.0 | 0.0 |
| 123512 | BRD-K44353683 | YAPC | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 131570 | BRD-K44353683 | A549 | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 131605 | BRD-K44353683 | HA1E | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.36 | -1.22 | 1.25 |
| 131647 | BRD-K44353683 | HEK293 | 0.01 uM | 24 h | 0.24 | 1.02 | 0.13 | 0.24 | 0.86 | 0.16 |
| 131674 | BRD-K44353683 | HELA | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.29 | 1.02 | 0.49 |
| 131698 | BRD-K44353683 | HT29 | 2.22 uM | 24 h | 0.21 | 0.87 | 0.01 | 0.31 | 1.11 | 0.72 |
| 131751 | BRD-K44353683 | HUVEC | 0.08 uM | 24 h | -0.21 | -0.87 | 0.02 | 0.0 | 0.0 | 0.0 |
| 131807 | BRD-K44353683 | JURKAT | 0.03 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 131910 | BRD-K44353683 | MDAMB231 | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.3 | -1.01 | 0.56 |