CMap Candidate Details
Structure:
| CMap ID: | C03684 |
| Pert ID: | BRD-A86871940 |
| Compound Name: | nicaraven |
| Targets: | |
| MoA: | free radical scavenger |
| SMILES: | CC(CNC(=O)c1cccnc1)NC(=O)c1cccnc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 125973 | BRD-A86871940 | A375 | 0.125 uM | 24 h | -0.2 | -0.83 | 0.0 | 0.28 | 0.99 | 0.39 |
| 126040 | BRD-A86871940 | HELA | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 126156 | BRD-A86871940 | JURKAT | 0.04 uM | 24 h | 0.33 | 1.37 | 0.97 | 0.0 | 0.0 | 0.0 |
| 126207 | BRD-A86871940 | MCF10A | 0.04 uM | 24 h | 0.22 | 0.92 | 0.04 | 0.3 | 1.05 | 0.57 |
| 126277 | BRD-A86871940 | PC3 | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 126326 | BRD-A86871940 | THP1 | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 134055 | BRD-A86871940 | A549 | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 134078 | BRD-A86871940 | HA1E | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 134130 | BRD-A86871940 | HEK293 | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 134198 | BRD-A86871940 | HT29 | 2.22 uM | 24 h | 0.21 | 0.9 | 0.02 | 0.0 | 0.0 | 0.0 |
| 134215 | BRD-A86871940 | HUVEC | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 134245 | BRD-A86871940 | MCF??7.00 | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 134277 | BRD-A86871940 | MDAMB231 | 0.03 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.32 | -1.09 | 0.82 |
| 134332 | BRD-A86871940 | YAPC | 0.01 uM | 24 h | -0.22 | -0.91 | 0.05 | 0.19 | 0.69 | 0.01 |